C16H14F3N5O2 — CID 5271751
3-[[6-(dimethylamino)-2-(trifluoromethyl)purin-9-yl]methyl]benzoic acid (PubChem CID 5271751) has the molecular formula C16H14F3N5O2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 3-[[6-(dimethylamino)-2-(trifluoromethyl)purin-9-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-(dimethylamino)-2-(trifluoromethyl)purin-9-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 5271751 |
| Molecular Formula | C16H14F3N5O2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-[[6-(dimethylamino)-2-(trifluoromethyl)purin-9-yl]methyl]benzoic acid |
| SMILES | CN(C)c1nc(C(F)(F)F)nc2c1ncn2Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14F3N5O2/c1-23(2)12-11-13(22-15(21-12)16(17,18)19)24(8-20-11)7-9-4-3-5-10(6-9)14(25)26/h3-6,8H,7H2,1-2H3,(H,25,26) |
| InChIKey | SCXRGGOOSQTZBO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |