About (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate (PubChem CID 5271803) has the molecular formula C20H21N5O6S
and a molecular weight of 459.48 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate.
Molecular Properties
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate |
| PubChem CID | 5271803 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate |
| SMILES | COS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2c1 |
| InChI | InChI=1S/C19H17N5O2.CH4O4S/c20-17(21)14-2-1-13-10-16(8-5-12(13)9-14)26-18(25)11-3-6-15(7-4-11)24-19(22)23;1-5-6(2,3)4/h1-10H,(H3,20,21)(H4,22,23,24);1H3,(H,2,3,4) |
| InChIKey | OEUHCISMCVNSMR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 204.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate?
The IUPAC name of (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate (CID 5271803) is (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate.
What is the SMILES notation for (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate?
The canonical SMILES for (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate is COS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2c1.
What is the InChIKey of (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate?
The InChIKey is OEUHCISMCVNSMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2.CH4O4S/c20-17(21)14-2-1-13-10-16(8-5-12(13)9-14)26-18(25)11-3-6-15(7-4-11)24-19(22)23;1-5-6(2,3)4/h1-10H,(H3,20,21)(H4,22,23,24);1H3,(H,2,3,4).
What are the key properties of (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate?
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate has a molecular weight of 459.48 g/mol, XLogP of 1.68, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methyl hydrogen sulfate is sourced from PubChem (CID 5271803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).