About 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene
2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene (PubChem CID 527194) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene.
Molecular Properties
| Compound Name | 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene |
| PubChem CID | 527194 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene |
| SMILES | C=C(C)C12CCC3(C1)C(C)CC=CC3(C)O2 |
| InChI | InChI=1S/C15H22O/c1-11(2)15-9-8-14(10-15)12(3)6-5-7-13(14,4)16-15/h5,7,12H,1,6,8-10H2,2-4H3 |
| InChIKey | RJDKCAMBNKUPIB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene?
The IUPAC name of 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene (CID 527194) is 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene.
What is the SMILES notation for 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene?
The canonical SMILES for 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene is C=C(C)C12CCC3(C1)C(C)CC=CC3(C)O2.
What is the InChIKey of 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene?
The InChIKey is RJDKCAMBNKUPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-11(2)15-9-8-14(10-15)12(3)6-5-7-13(14,4)16-15/h5,7,12H,1,6,8-10H2,2-4H3.
What are the key properties of 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene?
2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene has a molecular weight of 218.34 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-8-prop-1-en-2-yl-7-oxatricyclo[6.2.1.01,6]undec-4-ene is sourced from PubChem (CID 527194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).