About 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine
4-phenyl-5H-pyridazino[4,3-b]indol-3-amine (PubChem CID 5272072) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine.
Molecular Properties
| Compound Name | 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine |
| PubChem CID | 5272072 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine |
| SMILES | Nc1nnc2c([nH]c3ccccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C16H12N4/c17-16-13(10-6-2-1-3-7-10)15-14(19-20-16)11-8-4-5-9-12(11)18-15/h1-9,18H,(H2,17,20) |
| InChIKey | DHDZFJQQXROKLC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine?
The IUPAC name of 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine (CID 5272072) is 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine.
What is the SMILES notation for 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine?
The canonical SMILES for 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine is Nc1nnc2c([nH]c3ccccc32)c1-c1ccccc1.
What is the InChIKey of 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine?
The InChIKey is DHDZFJQQXROKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c17-16-13(10-6-2-1-3-7-10)15-14(19-20-16)11-8-4-5-9-12(11)18-15/h1-9,18H,(H2,17,20).
What are the key properties of 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine?
4-phenyl-5H-pyridazino[4,3-b]indol-3-amine has a molecular weight of 260.30 g/mol, XLogP of 3.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5H-pyridazino[4,3-b]indol-3-amine is sourced from PubChem (CID 5272072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).