About tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate
tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 5272274) has the molecular formula C23H34N4O3S
and a molecular weight of 446.62 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 5272274 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(-c2csc(NC(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C23H34N4O3S/c1-6-8-14-27(15-9-7-2)21(28)24-18-12-10-17(11-13-18)19-16-31-20(25-19)26-22(29)30-23(3,4)5/h10-13,16H,6-9,14-15H2,1-5H3,(H,24,28)(H,25,26,29) |
| InChIKey | OHYXXOYLKWXXMB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate (CID 5272274) is tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate is CCCCN(CCCC)C(=O)Nc1ccc(-c2csc(NC(=O)OC(C)(C)C)n2)cc1.
What is the InChIKey of tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is OHYXXOYLKWXXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N4O3S/c1-6-8-14-27(15-9-7-2)21(28)24-18-12-10-17(11-13-18)19-16-31-20(25-19)26-22(29)30-23(3,4)5/h10-13,16H,6-9,14-15H2,1-5H3,(H,24,28)(H,25,26,29).
What are the key properties of tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 446.62 g/mol, XLogP of 6.59, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-[4-(dibutylcarbamoylamino)phenyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 5272274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).