C16H19N3S — CID 52724779
3-cyclopentylsulfanyl-5-cyclopropyl-4-phenyl-1,2,4-triazole (PubChem CID 52724779) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 3-cyclopentylsulfanyl-5-cyclopropyl-4-phenyl-1,2,4-triazole.
| Compound Name | 3-cyclopentylsulfanyl-5-cyclopropyl-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 52724779 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-cyclopentylsulfanyl-5-cyclopropyl-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(-n2c(SC3CCCC3)nnc2C2CC2)cc1 |
| InChI | InChI=1S/C16H19N3S/c1-2-6-13(7-3-1)19-15(12-10-11-12)17-18-16(19)20-14-8-4-5-9-14/h1-3,6-7,12,14H,4-5,8-11H2 |
| InChIKey | ZXYBAURRRMPWNV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |