About N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide
N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide (PubChem CID 5272559) has the molecular formula C17H13FN2OS
and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide |
| PubChem CID | 5272559 |
| Molecular Formula | C17H13FN2OS |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C17H13FN2OS/c18-15-3-1-2-12(8-15)9-19-17(21)14-6-4-13(5-7-14)16-10-22-11-20-16/h1-8,10-11H,9H2,(H,19,21) |
| InChIKey | XOOANFPGFXBOKO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide?
The IUPAC name of N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide (CID 5272559) is N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide.
What is the SMILES notation for N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide?
The canonical SMILES for N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide is O=C(NCc1cccc(F)c1)c1ccc(-c2cscn2)cc1.
What is the InChIKey of N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide?
The InChIKey is XOOANFPGFXBOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2OS/c18-15-3-1-2-12(8-15)9-19-17(21)14-6-4-13(5-7-14)16-10-22-11-20-16/h1-8,10-11H,9H2,(H,19,21).
What are the key properties of N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide?
N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide has a molecular weight of 312.37 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide is sourced from PubChem (CID 5272559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).