About N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide
N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide (PubChem CID 5272562) has the molecular formula C19H17N3O2S
and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide |
| PubChem CID | 5272562 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(-c2cscn2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c23-18(20-10-14-4-2-1-3-5-14)11-21-19(24)16-8-6-15(7-9-16)17-12-25-13-22-17/h1-9,12-13H,10-11H2,(H,20,23)(H,21,24) |
| InChIKey | NPHFJLJOBYCQCZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide?
The IUPAC name of N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide (CID 5272562) is N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide.
What is the SMILES notation for N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide?
The canonical SMILES for N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide is O=C(CNC(=O)c1ccc(-c2cscn2)cc1)NCc1ccccc1.
What is the InChIKey of N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide?
The InChIKey is NPHFJLJOBYCQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2S/c23-18(20-10-14-4-2-1-3-5-14)11-21-19(24)16-8-6-15(7-9-16)17-12-25-13-22-17/h1-9,12-13H,10-11H2,(H,20,23)(H,21,24).
What are the key properties of N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide?
N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide has a molecular weight of 351.43 g/mol, XLogP of 2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(benzylamino)-2-oxoethyl]-4-(1,3-thiazol-4-yl)benzamide is sourced from PubChem (CID 5272562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).