About 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile
2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile (PubChem CID 5272631) has the molecular formula C16H12ClNO
and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile |
| PubChem CID | 5272631 |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCC(c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C16H12ClNO/c17-14-5-2-12(3-6-14)15-8-4-13-9-11(10-18)1-7-16(13)19-15/h1-3,5-7,9,15H,4,8H2 |
| InChIKey | NGHBVRHRJGHLND-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile?
The IUPAC name of 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile (CID 5272631) is 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile.
What is the SMILES notation for 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile?
The canonical SMILES for 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile is N#Cc1ccc2c(c1)CCC(c1ccc(Cl)cc1)O2.
What is the InChIKey of 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile?
The InChIKey is NGHBVRHRJGHLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO/c17-14-5-2-12(3-6-14)15-8-4-13-9-11(10-18)1-7-16(13)19-15/h1-3,5-7,9,15H,4,8H2.
What are the key properties of 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile?
2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile has a molecular weight of 269.73 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3,4-dihydro-2H-chromene-6-carbonitrile is sourced from PubChem (CID 5272631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).