About m-Mentha-1(7),8-diene
m-Mentha-1(7),8-diene (PubChem CID 527272) has the molecular formula C10H16
and a molecular weight of 136.23 g/mol. Its IUPAC name is 1-methylidene-3-prop-1-en-2-ylcyclohexane.
Molecular Properties
| Compound Name | m-Mentha-1(7),8-diene |
| PubChem CID | 527272 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.23 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1-methylidene-3-prop-1-en-2-ylcyclohexane |
| SMILES | CC(=C)C1CCCC(=C)C1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h10H,1,3-7H2,2H3 |
| InChIKey | IRKOFIFCPOQHKY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 153 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze m-Mentha-1(7),8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of m-Mentha-1(7),8-diene?
The IUPAC name of m-Mentha-1(7),8-diene (CID 527272) is 1-methylidene-3-prop-1-en-2-ylcyclohexane.
What is the SMILES notation for m-Mentha-1(7),8-diene?
The canonical SMILES for m-Mentha-1(7),8-diene is CC(=C)C1CCCC(=C)C1.
What is the InChIKey of m-Mentha-1(7),8-diene?
The InChIKey is IRKOFIFCPOQHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h10H,1,3-7H2,2H3.
What are the key properties of m-Mentha-1(7),8-diene?
m-Mentha-1(7),8-diene has a molecular weight of 136.23 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for m-Mentha-1(7),8-diene is sourced from PubChem (CID 527272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).