About 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole
4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole (PubChem CID 5272771) has the molecular formula C21H26N2OS
and a molecular weight of 354.52 g/mol. Its IUPAC name is 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole |
| PubChem CID | 5272771 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole |
| SMILES | Cc1csc(CCCCCCCOc2cc(C)c3ccccc3n2)n1 |
| InChI | InChI=1S/C21H26N2OS/c1-16-14-20(23-19-11-8-7-10-18(16)19)24-13-9-5-3-4-6-12-21-22-17(2)15-25-21/h7-8,10-11,14-15H,3-6,9,12-13H2,1-2H3 |
| InChIKey | GQCZPHACLJNCMC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole?
The IUPAC name of 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole (CID 5272771) is 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole.
What is the SMILES notation for 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole?
The canonical SMILES for 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole is Cc1csc(CCCCCCCOc2cc(C)c3ccccc3n2)n1.
What is the InChIKey of 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole?
The InChIKey is GQCZPHACLJNCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2OS/c1-16-14-20(23-19-11-8-7-10-18(16)19)24-13-9-5-3-4-6-12-21-22-17(2)15-25-21/h7-8,10-11,14-15H,3-6,9,12-13H2,1-2H3.
What are the key properties of 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole?
4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole has a molecular weight of 354.52 g/mol, XLogP of 5.88, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[7-(4-methylquinolin-2-yl)oxyheptyl]-1,3-thiazole is sourced from PubChem (CID 5272771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).