C11H8BrF3N2S — CID 52727902
2-(2-bromoprop-2-enylsulfanyl)-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 52727902) has the molecular formula C11H8BrF3N2S and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-(2-bromoprop-2-enylsulfanyl)-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-bromoprop-2-enylsulfanyl)-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 52727902 |
| Molecular Formula | C11H8BrF3N2S |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2-(2-bromoprop-2-enylsulfanyl)-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | C=C(Br)CSc1nc(C)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C11H8BrF3N2S/c1-6(12)5-18-10-8(4-16)9(11(13,14)15)3-7(2)17-10/h3H,1,5H2,2H3 |
| InChIKey | RDMWATZRGLGTEY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |