C20H23N2O9P — CID 5272833
(2,6-dimethylphenyl) [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 5272833) has the molecular formula C20H23N2O9P and a molecular weight of 466.38 g/mol. Its IUPAC name is (2,6-dimethylphenyl) [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (2,6-dimethylphenyl) [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 5272833 |
| Molecular Formula | C20H23N2O9P |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (2,6-dimethylphenyl) [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)Oc3c(C)cccc3C)[C@@H](O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H23N2O9P/c1-4-6-13-9-22(20(26)21-18(13)25)19-16(24)15(23)14(30-19)10-29-32(27,28)31-17-11(2)7-5-8-12(17)3/h5,7-9,14-16,19,23-24H,10H2,1-3H3,(H,27,28)(H,21,25,26)/t14-,15-,16+,19-/m1/s1 |
| InChIKey | WMPWIQZNKGNLNK-OAFZBRQQSA-N |
| XLogP | 0.34 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|