C19H21N2O10P — CID 5272838
[(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-methoxyphenyl) hydrogen phosphate (PubChem CID 5272838) has the molecular formula C19H21N2O10P and a molecular weight of 468.36 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-methoxyphenyl) hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-methoxyphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 5272838 |
| Molecular Formula | C19H21N2O10P |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (4-methoxyphenyl) hydrogen phosphate |
| SMILES | CC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)Oc3ccc(OC)cc3)[C@@H](O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H21N2O10P/c1-3-4-11-9-21(19(25)20-17(11)24)18-16(23)15(22)14(30-18)10-29-32(26,27)31-13-7-5-12(28-2)6-8-13/h5-9,14-16,18,22-23H,10H2,1-2H3,(H,26,27)(H,20,24,25)/t14-,15-,16+,18-/m1/s1 |
| InChIKey | GKCHSCPVLHEXCK-XLMAVXFVSA-N |
| XLogP | -0.27 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|