C16H18F3NO3 — CID 5272861
3-methylbut-2-enyl 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 5272861) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-methylbut-2-enyl 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | 3-methylbut-2-enyl 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 5272861 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-methylbut-2-enyl 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CC(C)=CCOC(=O)CC(NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H18F3NO3/c1-11(2)8-9-23-14(21)10-13(12-6-4-3-5-7-12)20-15(22)16(17,18)19/h3-8,13H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | ZWLIOBOICHSKGK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|