About [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate
[2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate (PubChem CID 5272998) has the molecular formula C20H24N2O4Se2
and a molecular weight of 514.34 g/mol. Its IUPAC name is [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate.
Molecular Properties
| Compound Name | [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate |
| PubChem CID | 5272998 |
| Molecular Formula | C20H24N2O4Se2 |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccccc1[Se][Se]c1ccccc1OC(=O)NCCC |
| InChI | InChI=1S/C20H24N2O4Se2/c1-3-13-21-19(23)25-15-9-5-7-11-17(15)27-28-18-12-8-6-10-16(18)26-20(24)22-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | CZUYEMOFDXOFJJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate?
The IUPAC name of [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate (CID 5272998) is [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate.
What is the SMILES notation for [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate?
The canonical SMILES for [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate is CCCNC(=O)Oc1ccccc1[Se][Se]c1ccccc1OC(=O)NCCC.
What is the InChIKey of [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate?
The InChIKey is CZUYEMOFDXOFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O4Se2/c1-3-13-21-19(23)25-15-9-5-7-11-17(15)27-28-18-12-8-6-10-16(18)26-20(24)22-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate?
[2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate has a molecular weight of 514.34 g/mol, XLogP of 1.96, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-(propylcarbamoyloxy)phenyl]diselanyl]phenyl] N-propylcarbamate is sourced from PubChem (CID 5272998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).