C14H11Cl3FNO4 — CID 5273003
2,5,6-trichloro-1-[(2R,3R,4S,5S)-5-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]indole-3-carbaldehyde (PubChem CID 5273003) has the molecular formula C14H11Cl3FNO4 and a molecular weight of 382.60 g/mol. Its IUPAC name is 2,5,6-trichloro-1-[(2R,3R,4S,5S)-5-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]indole-3-carbaldehyde.
| Compound Name | 2,5,6-trichloro-1-[(2R,3R,4S,5S)-5-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 5273003 |
| Molecular Formula | C14H11Cl3FNO4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,5,6-trichloro-1-[(2R,3R,4S,5S)-5-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]indole-3-carbaldehyde |
| SMILES | O=Cc1c(Cl)n([C@@H]2O[C@H](CF)[C@@H](O)[C@H]2O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C14H11Cl3FNO4/c15-7-1-5-6(4-20)13(17)19(9(5)2-8(7)16)14-12(22)11(21)10(3-18)23-14/h1-2,4,10-12,14,21-22H,3H2/t10-,11-,12-,14-/m1/s1 |
| InChIKey | MAEINUIQSYLOSS-HKUMRIAESA-N |
| XLogP | 3.00 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|