C22H38O5Si2 — CID 5273065
(6aR,8S,9S,9aS)-2-ethyl-8-phenyl-2,4,4-tri(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 5273065) has the molecular formula C22H38O5Si2 and a molecular weight of 438.71 g/mol. Its IUPAC name is (6aR,8S,9S,9aS)-2-ethyl-8-phenyl-2,4,4-tri(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8S,9S,9aS)-2-ethyl-8-phenyl-2,4,4-tri(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 5273065 |
| Molecular Formula | C22H38O5Si2 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (6aR,8S,9S,9aS)-2-ethyl-8-phenyl-2,4,4-tri(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | CC[Si]1(C(C)C)O[C@H]2[C@@H](O)[C@H](c3ccccc3)O[C@@H]2CO[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H38O5Si2/c1-8-28(15(2)3)26-22-19(14-24-29(27-28,16(4)5)17(6)7)25-21(20(22)23)18-12-10-9-11-13-18/h9-13,15-17,19-23H,8,14H2,1-7H3/t19-,20+,21+,22-,28?/m1/s1 |
| InChIKey | FQMOYYYLUKZCSP-XPPMBEBSSA-N |
| XLogP | 5.05 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|