C23H40O5Si2 — CID 5273068
(6aR,9S,9aS)-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 5273068) has the molecular formula C23H40O5Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is (6aR,9S,9aS)-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,9S,9aS)-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 5273068 |
| Molecular Formula | C23H40O5Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (6aR,9S,9aS)-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2OC(c3ccccc3)[C@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C23H40O5Si2/c1-15(2)29(16(3)4)25-14-20-23(27-30(28-29,17(5)6)18(7)8)21(24)22(26-20)19-12-10-9-11-13-19/h9-13,15-18,20-24H,14H2,1-8H3/t20-,21+,22?,23-/m1/s1 |
| InChIKey | GQJICSKFBFQKJV-HNTVYWHESA-N |
| XLogP | 5.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|