C17H12ClN3O — CID 5273073
2-(4-chlorophenyl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 5273073) has the molecular formula C17H12ClN3O and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | 2-(4-chlorophenyl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 5273073 |
| Molecular Formula | C17H12ClN3O |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(4-chlorophenyl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | Cc1ccc2ncc3c(=O)n(-c4ccc(Cl)cc4)[nH]c3c2c1 |
| InChI | InChI=1S/C17H12ClN3O/c1-10-2-7-15-13(8-10)16-14(9-19-15)17(22)21(20-16)12-5-3-11(18)4-6-12/h2-9,20H,1H3 |
| InChIKey | IVXBWAAYSJGRKH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|