About 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole
5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole (PubChem CID 5273088) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole.
Molecular Properties
| Compound Name | 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole |
| PubChem CID | 5273088 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole |
| SMILES | Cc1ccc(CCCOc2c(C)cc(-c3nnn(C)n3)cc2C)o1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-10-15(18-19-21-22(4)20-18)11-13(2)17(12)23-9-5-6-16-8-7-14(3)24-16/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | GFADXOATPKWKQD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole?
The IUPAC name of 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole (CID 5273088) is 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole.
What is the SMILES notation for 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole?
The canonical SMILES for 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole is Cc1ccc(CCCOc2c(C)cc(-c3nnn(C)n3)cc2C)o1.
What is the InChIKey of 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole?
The InChIKey is GFADXOATPKWKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-12-10-15(18-19-21-22(4)20-18)11-13(2)17(12)23-9-5-6-16-8-7-14(3)24-16/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole?
5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole has a molecular weight of 326.40 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-dimethyl-4-[3-(5-methylfuran-2-yl)propoxy]phenyl]-2-methyltetrazole is sourced from PubChem (CID 5273088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).