C19H34N6O8 — CID 5273283
(2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(6-aminohexylcarbamoyloxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 5273283) has the molecular formula C19H34N6O8 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(6-aminohexylcarbamoyloxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(6-aminohexylcarbamoyloxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 5273283 |
| Molecular Formula | C19H34N6O8 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(6-aminohexylcarbamoyloxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](OC(=O)NCCCCCCN)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C19H34N6O8/c1-10(27)24-14-11(25-18(21)22)8-13(17(29)30)32-16(14)15(12(28)9-26)33-19(31)23-7-5-3-2-4-6-20/h8,11-12,14-16,26,28H,2-7,9,20H2,1H3,(H,23,31)(H,24,27)(H,29,30)(H4,21,22,25)/t11-,12+,14+,15+,16+/m0/s1 |
| InChIKey | UJHGUMWVUGECHO-OVJXPFRRSA-N |
| XLogP | -2.53 |
| TPSA | 244.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|