About (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one
(4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 5273357) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 5273357 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Cc1cc(O)c2c(c1)[C@H](O)CCC2=O |
| InChI | InChI=1S/C11H12O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h4-5,8,12,14H,2-3H2,1H3/t8-/m1/s1 |
| InChIKey | JOCZVRFSKAUXRP-MRVPVSSYSA-N |
| XLogP | 1.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one (CID 5273357) is (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one is Cc1cc(O)c2c(c1)[C@H](O)CCC2=O.
What is the InChIKey of (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is JOCZVRFSKAUXRP-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H12O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h4-5,8,12,14H,2-3H2,1H3/t8-/m1/s1.
What are the key properties of (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
(4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 192.21 g/mol, XLogP of 1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,8-dihydroxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 5273357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).