C28H54O9 — CID 5273359
(2R,3R,4S,5S,6R)-2-[(3R,4R,5S,6R)-3,4-dihydroxy-6-methyl-5-octoxyoxan-2-yl]oxy-6-methyl-5-octoxyoxane-3,4-diol (PubChem CID 5273359) has the molecular formula C28H54O9 and a molecular weight of 534.73 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3R,4R,5S,6R)-3,4-dihydroxy-6-methyl-5-octoxyoxan-2-yl]oxy-6-methyl-5-octoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3R,4R,5S,6R)-3,4-dihydroxy-6-methyl-5-octoxyoxan-2-yl]oxy-6-methyl-5-octoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 5273359 |
| Molecular Formula | C28H54O9 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3R,4R,5S,6R)-3,4-dihydroxy-6-methyl-5-octoxyoxan-2-yl]oxy-6-methyl-5-octoxyoxane-3,4-diol |
| SMILES | CCCCCCCCO[C@H]1[C@@H](O)[C@@H](O)[C@@H](OC2O[C@H](C)[C@@H](OCCCCCCCC)[C@H](O)[C@H]2O)O[C@@H]1C |
| InChI | InChI=1S/C28H54O9/c1-5-7-9-11-13-15-17-33-25-19(3)35-27(23(31)21(25)29)37-28-24(32)22(30)26(20(4)36-28)34-18-16-14-12-10-8-6-2/h19-32H,5-18H2,1-4H3/t19-,20-,21-,22+,23-,24-,25-,26-,27?,28-/m1/s1 |
| InChIKey | VOOJHYHHTJRQBK-LFWVFXIISA-N |
| XLogP | 3.43 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|