C8H11N5OS — CID 5273434
5-[(1-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 5273434) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is 5-[(1-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[(1-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 5273434 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 5-[(1-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCn1nc(Cc2n[nH]c(=S)o2)nc1C |
| InChI | InChI=1S/C8H11N5OS/c1-3-13-5(2)9-6(12-13)4-7-10-11-8(15)14-7/h3-4H2,1-2H3,(H,11,15) |
| InChIKey | NVPYEPMJUAIUAV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|