C9H7N5O4S — CID 5273659
5-[(3,5-dinitrophenyl)methylsulfanyl]-1H-1,2,4-triazole (PubChem CID 5273659) has the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. Its IUPAC name is 5-[(3,5-dinitrophenyl)methylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 5273659 |
| Molecular Formula | C9H7N5O4S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 5-[(3,5-dinitrophenyl)methylsulfanyl]-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(CSc2ncn[nH]2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7N5O4S/c15-13(16)7-1-6(2-8(3-7)14(17)18)4-19-9-10-5-11-12-9/h1-3,5H,4H2,(H,10,11,12) |
| InChIKey | VEDDXEDOPIMCMA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|