C13H19NO9 — CID 5273672
[(E,2R,3R)-2,3-diacetyloxy-6-hydroxy-7-nitrohept-4-enyl] acetate (PubChem CID 5273672) has the molecular formula C13H19NO9 and a molecular weight of 333.29 g/mol. Its IUPAC name is [(E,2R,3R)-2,3-diacetyloxy-6-hydroxy-7-nitrohept-4-enyl] acetate.
| Compound Name | [(E,2R,3R)-2,3-diacetyloxy-6-hydroxy-7-nitrohept-4-enyl] acetate |
|---|---|
| PubChem CID | 5273672 |
| Molecular Formula | C13H19NO9 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(E,2R,3R)-2,3-diacetyloxy-6-hydroxy-7-nitrohept-4-enyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](/C=C/C(O)C[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C13H19NO9/c1-8(15)21-7-13(23-10(3)17)12(22-9(2)16)5-4-11(18)6-14(19)20/h4-5,11-13,18H,6-7H2,1-3H3/b5-4+/t11?,12-,13-/m1/s1 |
| InChIKey | VBMLPKWOFIJVIE-DRMPTPDWSA-N |
| XLogP | -0.39 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|