C14H21NO9 — CID 5273673
[(E,2R,3S)-2,3-diacetyloxy-6-hydroxy-7-nitrooct-4-enyl] acetate (PubChem CID 5273673) has the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. Its IUPAC name is [(E,2R,3S)-2,3-diacetyloxy-6-hydroxy-7-nitrooct-4-enyl] acetate.
| Compound Name | [(E,2R,3S)-2,3-diacetyloxy-6-hydroxy-7-nitrooct-4-enyl] acetate |
|---|---|
| PubChem CID | 5273673 |
| Molecular Formula | C14H21NO9 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(E,2R,3S)-2,3-diacetyloxy-6-hydroxy-7-nitrooct-4-enyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](/C=C/C(O)C(C)[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C14H21NO9/c1-8(15(20)21)12(19)5-6-13(23-10(3)17)14(24-11(4)18)7-22-9(2)16/h5-6,8,12-14,19H,7H2,1-4H3/b6-5+/t8?,12?,13-,14+/m0/s1 |
| InChIKey | IFUOKCZQGAMMSQ-WNZGRKEJSA-N |
| XLogP | -0.00 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|