C14H19NO8 — CID 5273675
[(2R,3S,4E,6E)-2,3-diacetyloxy-7-nitroocta-4,6-dienyl] acetate (PubChem CID 5273675) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(2R,3S,4E,6E)-2,3-diacetyloxy-7-nitroocta-4,6-dienyl] acetate.
| Compound Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-7-nitroocta-4,6-dienyl] acetate |
|---|---|
| PubChem CID | 5273675 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-7-nitroocta-4,6-dienyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](/C=C/C=C(\C)[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C14H19NO8/c1-9(15(19)20)6-5-7-13(22-11(3)17)14(23-12(4)18)8-21-10(2)16/h5-7,13-14H,8H2,1-4H3/b7-5+,9-6+/t13-,14+/m0/s1 |
| InChIKey | GFZRDVUMQLLWTF-KOQPQKEPSA-N |
| XLogP | 1.15 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|