C18H29NO9 — CID 5273677
[(2R,3S)-7-acetamido-2,3,6-triacetyloxyoctyl] acetate (PubChem CID 5273677) has the molecular formula C18H29NO9 and a molecular weight of 403.43 g/mol. Its IUPAC name is [(2R,3S)-7-acetamido-2,3,6-triacetyloxyoctyl] acetate.
| Compound Name | [(2R,3S)-7-acetamido-2,3,6-triacetyloxyoctyl] acetate |
|---|---|
| PubChem CID | 5273677 |
| Molecular Formula | C18H29NO9 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(2R,3S)-7-acetamido-2,3,6-triacetyloxyoctyl] acetate |
| SMILES | CC(=O)NC(C)C(CC[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H29NO9/c1-10(19-11(2)20)16(26-13(4)22)7-8-17(27-14(5)23)18(28-15(6)24)9-25-12(3)21/h10,16-18H,7-9H2,1-6H3,(H,19,20)/t10?,16?,17-,18+/m0/s1 |
| InChIKey | IESMLJLZPLSUIS-XGYGUGDJSA-N |
| XLogP | 0.65 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|