About 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one
2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one (PubChem CID 5273755) has the molecular formula C18H16O7
and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
| PubChem CID | 5273755 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1OC |
| InChI | InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3 |
| InChIKey | DRRWBCNQOKKKOL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one (CID 5273755) is 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one is COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one?
The InChIKey is DRRWBCNQOKKKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O7/c1-22-12-5-4-9(6-14(12)23-2)13-7-10(19)16-15(25-13)8-11(20)18(24-3)17(16)21/h4-8,20-21H,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one?
2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one has a molecular weight of 344.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one is sourced from PubChem (CID 5273755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).