C20H11NO6 — CID 5273783
10-(1,3-benzodioxol-5-yl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione (PubChem CID 5273783) has the molecular formula C20H11NO6 and a molecular weight of 361.31 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
|---|---|
| PubChem CID | 5273783 |
| Molecular Formula | C20H11NO6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
| SMILES | O=C1NC(=O)c2c1cc1ccc3c(c1c2-c1ccc2c(c1)OCO2)OCO3 |
| InChI | InChI=1S/C20H11NO6/c22-19-11-5-9-2-4-13-18(27-8-25-13)16(9)15(17(11)20(23)21-19)10-1-3-12-14(6-10)26-7-24-12/h1-6H,7-8H2,(H,21,22,23) |
| InChIKey | BKIXKBUXQUXJOF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|