C21H15NO6 — CID 5273785
10-(3,4-dimethoxyphenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione (PubChem CID 5273785) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is 10-(3,4-dimethoxyphenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione.
| Compound Name | 10-(3,4-dimethoxyphenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
|---|---|
| PubChem CID | 5273785 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 10-(3,4-dimethoxyphenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
| SMILES | COc1ccc(-c2c3c(cc4ccc5c(c24)OCO5)C(=O)NC3=O)cc1OC |
| InChI | InChI=1S/C21H15NO6/c1-25-13-5-3-11(8-15(13)26-2)16-17-10(4-6-14-19(17)28-9-27-14)7-12-18(16)21(24)22-20(12)23/h3-8H,9H2,1-2H3,(H,22,23,24) |
| InChIKey | PYUGWYMMPXGDSQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|