C11H17N3O2 — CID 5273916
4-amino-1-[(1S,3R)-3-(hydroxymethyl)cyclohexyl]pyrimidin-2-one (PubChem CID 5273916) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-amino-1-[(1S,3R)-3-(hydroxymethyl)cyclohexyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1S,3R)-3-(hydroxymethyl)cyclohexyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 5273916 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 4-amino-1-[(1S,3R)-3-(hydroxymethyl)cyclohexyl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2CCC[C@@H](CO)C2)c(=O)n1 |
| InChI | InChI=1S/C11H17N3O2/c12-10-4-5-14(11(16)13-10)9-3-1-2-8(6-9)7-15/h4-5,8-9,15H,1-3,6-7H2,(H2,12,13,16)/t8-,9+/m1/s1 |
| InChIKey | KYBALDDLTQQPNW-BDAKNGLRSA-N |
| XLogP | 0.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |