C19H22N4O6 — CID 5274097
N-[7-[(2R,5S)-5-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]acetamide (PubChem CID 5274097) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[7-[(2R,5S)-5-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-[7-[(2R,5S)-5-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 5274097 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[7-[(2R,5S)-5-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ncnc2c([C@H]3C=C[C@@H](COC4(C)OC(=O)C(C)(C)O4)O3)c[nH]c12 |
| InChI | InChI=1S/C19H22N4O6/c1-10(24)23-16-15-14(21-9-22-16)12(7-20-15)13-6-5-11(27-13)8-26-19(4)28-17(25)18(2,3)29-19/h5-7,9,11,13,20H,8H2,1-4H3,(H,21,22,23,24)/t11-,13+,19?/m0/s1 |
| InChIKey | GEDBKLVQJCSZJE-UXVCLIMPSA-N |
| XLogP | 1.95 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|