C11H12N4O3 — CID 5274099
[(2R,4S)-4-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 5274099) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is [(2R,4S)-4-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(2R,4S)-4-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 5274099 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [(2R,4S)-4-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | Nc1ncnc2c([C@@H]3O[C@H](CO)C4OC43)c[nH]c12 |
| InChI | InChI=1S/C11H12N4O3/c12-11-7-6(14-3-15-11)4(1-13-7)8-10-9(18-10)5(2-16)17-8/h1,3,5,8-10,13,16H,2H2,(H2,12,14,15)/t5-,8+,9?,10?/m1/s1 |
| InChIKey | NGFUYNYPVKTEJR-IBURAEQXSA-N |
| XLogP | -0.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|