About 3-sulfanylbutanal
3-sulfanylbutanal (PubChem CID 527443) has the molecular formula C4H8OS
and a molecular weight of 104.17 g/mol. Its IUPAC name is 3-sulfanylbutanal.
Molecular Properties
| Compound Name | 3-sulfanylbutanal |
| PubChem CID | 527443 |
| Molecular Formula | C4H8OS |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 3-sulfanylbutanal |
| SMILES | CC(S)CC=O |
| InChI | InChI=1S/C4H8OS/c1-4(6)2-3-5/h3-4,6H,2H2,1H3 |
| InChIKey | USJRMLZTONLKON-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylbutanal?
The IUPAC name of 3-sulfanylbutanal (CID 527443) is 3-sulfanylbutanal.
What is the SMILES notation for 3-sulfanylbutanal?
The canonical SMILES for 3-sulfanylbutanal is CC(S)CC=O.
What is the InChIKey of 3-sulfanylbutanal?
The InChIKey is USJRMLZTONLKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OS/c1-4(6)2-3-5/h3-4,6H,2H2,1H3.
What are the key properties of 3-sulfanylbutanal?
3-sulfanylbutanal has a molecular weight of 104.17 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylbutanal is sourced from PubChem (CID 527443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).