About 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one
5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 5274449) has the molecular formula C10H10O2S
and a molecular weight of 194.25 g/mol. Its IUPAC name is 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one |
| PubChem CID | 5274449 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | CC(=O)C1CCc2sccc2C1=O |
| InChI | InChI=1S/C10H10O2S/c1-6(11)7-2-3-9-8(10(7)12)4-5-13-9/h4-5,7H,2-3H2,1H3 |
| InChIKey | UOBJWEHBSJKKTA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one?
The IUPAC name of 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one (CID 5274449) is 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one.
What is the SMILES notation for 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one?
The canonical SMILES for 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one is CC(=O)C1CCc2sccc2C1=O.
What is the InChIKey of 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one?
The InChIKey is UOBJWEHBSJKKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S/c1-6(11)7-2-3-9-8(10(7)12)4-5-13-9/h4-5,7H,2-3H2,1H3.
What are the key properties of 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one?
5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one has a molecular weight of 194.25 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-6,7-dihydro-5H-1-benzothiophen-4-one is sourced from PubChem (CID 5274449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).