C28H30N4O2S — CID 5274768
2-(cyclohexanecarbonylamino)-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274768) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274768 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C28H30N4O2S/c33-26(30-15-14-29-18-19-10-11-20-6-4-5-9-22(20)16-19)23-12-13-24-25(17-23)35-28(31-24)32-27(34)21-7-2-1-3-8-21/h4-6,9-13,16-17,21,29H,1-3,7-8,14-15,18H2,(H,30,33)(H,31,32,34) |
| InChIKey | RFLAHGCHGNEDLB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|