C30H34N4O2S — CID 5274770
2-(cyclohexanecarbonylamino)-N-[4-(naphthalen-2-ylmethylamino)butyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274770) has the molecular formula C30H34N4O2S and a molecular weight of 514.70 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-[4-(naphthalen-2-ylmethylamino)butyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-[4-(naphthalen-2-ylmethylamino)butyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274770 |
| Molecular Formula | C30H34N4O2S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-[4-(naphthalen-2-ylmethylamino)butyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C30H34N4O2S/c35-28(32-17-7-6-16-31-20-21-12-13-22-8-4-5-11-24(22)18-21)25-14-15-26-27(19-25)37-30(33-26)34-29(36)23-9-2-1-3-10-23/h4-5,8,11-15,18-19,23,31H,1-3,6-7,9-10,16-17,20H2,(H,32,35)(H,33,34,36) |
| InChIKey | VVMDSTLRGNILOC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|