C31H36N4O2S — CID 5274771
2-(cyclohexanecarbonylamino)-N-[5-(naphthalen-2-ylmethylamino)pentyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274771) has the molecular formula C31H36N4O2S and a molecular weight of 528.72 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-[5-(naphthalen-2-ylmethylamino)pentyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-[5-(naphthalen-2-ylmethylamino)pentyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274771 |
| Molecular Formula | C31H36N4O2S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-[5-(naphthalen-2-ylmethylamino)pentyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C31H36N4O2S/c36-29(33-18-8-2-7-17-32-21-22-13-14-23-9-5-6-12-25(23)19-22)26-15-16-27-28(20-26)38-31(34-27)35-30(37)24-10-3-1-4-11-24/h5-6,9,12-16,19-20,24,32H,1-4,7-8,10-11,17-18,21H2,(H,33,36)(H,34,35,37) |
| InChIKey | OZPJYFKVXGFPAS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|