C19H19ClN2 — CID 52747724
4-[[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]benzonitrile (PubChem CID 52747724) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-[[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 52747724 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-[[(2S)-2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCC[C@H]2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2/c20-19-6-2-1-4-17(19)12-18-5-3-11-22(18)14-16-9-7-15(13-21)8-10-16/h1-2,4,6-10,18H,3,5,11-12,14H2/t18-/m0/s1 |
| InChIKey | FDZDFONAUACJIU-SFHVURJKSA-N |
| XLogP | 4.42 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |