C26H22N6O2S — CID 5274803
N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-(pyrazine-2-carbonylamino)-1,3-benzothiazole-6-carboxamide (PubChem CID 5274803) has the molecular formula C26H22N6O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-(pyrazine-2-carbonylamino)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-(pyrazine-2-carbonylamino)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274803 |
| Molecular Formula | C26H22N6O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-(pyrazine-2-carbonylamino)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)c3cnccn3)sc2c1 |
| InChI | InChI=1S/C26H22N6O2S/c33-24(30-12-10-27-15-17-5-6-18-3-1-2-4-19(18)13-17)20-7-8-21-23(14-20)35-26(31-21)32-25(34)22-16-28-9-11-29-22/h1-9,11,13-14,16,27H,10,12,15H2,(H,30,33)(H,31,32,34) |
| InChIKey | RTGNLCLVEHTZRB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|