C29H23F3N4O2S — CID 5274806
N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-[[4-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274806) has the molecular formula C29H23F3N4O2S and a molecular weight of 548.59 g/mol. Its IUPAC name is N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-[[4-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-[[4-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274806 |
| Molecular Formula | C29H23F3N4O2S |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | N-[2-(naphthalen-2-ylmethylamino)ethyl]-2-[[4-(trifluoromethyl)benzoyl]amino]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)c3ccc(C(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C29H23F3N4O2S/c30-29(31,32)23-10-7-20(8-11-23)27(38)36-28-35-24-12-9-22(16-25(24)39-28)26(37)34-14-13-33-17-18-5-6-19-3-1-2-4-21(19)15-18/h1-12,15-16,33H,13-14,17H2,(H,34,37)(H,35,36,38) |
| InChIKey | HMLAFIOESYVCJA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|