C30H28N4O4S — CID 5274807
2-[(2,5-dimethoxybenzoyl)amino]-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274807) has the molecular formula C30H28N4O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is 2-[(2,5-dimethoxybenzoyl)amino]-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[(2,5-dimethoxybenzoyl)amino]-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274807 |
| Molecular Formula | C30H28N4O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 2-[(2,5-dimethoxybenzoyl)amino]-N-[2-(naphthalen-2-ylmethylamino)ethyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2nc3ccc(C(=O)NCCNCc4ccc5ccccc5c4)cc3s2)c1 |
| InChI | InChI=1S/C30H28N4O4S/c1-37-23-10-12-26(38-2)24(17-23)29(36)34-30-33-25-11-9-22(16-27(25)39-30)28(35)32-14-13-31-18-19-7-8-20-5-3-4-6-21(20)15-19/h3-12,15-17,31H,13-14,18H2,1-2H3,(H,32,35)(H,33,34,36) |
| InChIKey | ZDQDVTJDANMHRR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|