About 5-hexyl-2-phenoxyphenol
5-hexyl-2-phenoxyphenol (PubChem CID 5274977) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-hexyl-2-phenoxyphenol.
Molecular Properties
| Compound Name | 5-hexyl-2-phenoxyphenol |
| PubChem CID | 5274977 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5-hexyl-2-phenoxyphenol |
| SMILES | CCCCCCc1ccc(Oc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C18H22O2/c1-2-3-4-6-9-15-12-13-18(17(19)14-15)20-16-10-7-5-8-11-16/h5,7-8,10-14,19H,2-4,6,9H2,1H3 |
| InChIKey | SXGQGHHNOWYMRT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-2-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-2-phenoxyphenol?
The IUPAC name of 5-hexyl-2-phenoxyphenol (CID 5274977) is 5-hexyl-2-phenoxyphenol.
What is the SMILES notation for 5-hexyl-2-phenoxyphenol?
The canonical SMILES for 5-hexyl-2-phenoxyphenol is CCCCCCc1ccc(Oc2ccccc2)c(O)c1.
What is the InChIKey of 5-hexyl-2-phenoxyphenol?
The InChIKey is SXGQGHHNOWYMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c1-2-3-4-6-9-15-12-13-18(17(19)14-15)20-16-10-7-5-8-11-16/h5,7-8,10-14,19H,2-4,6,9H2,1H3.
What are the key properties of 5-hexyl-2-phenoxyphenol?
5-hexyl-2-phenoxyphenol has a molecular weight of 270.37 g/mol, XLogP of 5.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-2-phenoxyphenol is sourced from PubChem (CID 5274977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).