About 5-octyl-2-phenoxyphenol
5-octyl-2-phenoxyphenol (PubChem CID 5274979) has the molecular formula C20H26O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-octyl-2-phenoxyphenol.
Molecular Properties
| Compound Name | 5-octyl-2-phenoxyphenol |
| PubChem CID | 5274979 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 5-octyl-2-phenoxyphenol |
| SMILES | CCCCCCCCc1ccc(Oc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C20H26O2/c1-2-3-4-5-6-8-11-17-14-15-20(19(21)16-17)22-18-12-9-7-10-13-18/h7,9-10,12-16,21H,2-6,8,11H2,1H3 |
| InChIKey | JOWYBLIPWAMIHM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-octyl-2-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-octyl-2-phenoxyphenol?
The IUPAC name of 5-octyl-2-phenoxyphenol (CID 5274979) is 5-octyl-2-phenoxyphenol.
What is the SMILES notation for 5-octyl-2-phenoxyphenol?
The canonical SMILES for 5-octyl-2-phenoxyphenol is CCCCCCCCc1ccc(Oc2ccccc2)c(O)c1.
What is the InChIKey of 5-octyl-2-phenoxyphenol?
The InChIKey is JOWYBLIPWAMIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O2/c1-2-3-4-5-6-8-11-17-14-15-20(19(21)16-17)22-18-12-9-7-10-13-18/h7,9-10,12-16,21H,2-6,8,11H2,1H3.
What are the key properties of 5-octyl-2-phenoxyphenol?
5-octyl-2-phenoxyphenol has a molecular weight of 298.43 g/mol, XLogP of 6.09, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-octyl-2-phenoxyphenol is sourced from PubChem (CID 5274979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).