About [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide
[1]benzothiolo[3,2-h]isoquinoline-6-carboxamide (PubChem CID 5274983) has the molecular formula C16H10N2OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide.
Molecular Properties
| Compound Name | [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide |
| PubChem CID | 5274983 |
| Molecular Formula | C16H10N2OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide |
| SMILES | NC(=O)c1cc2ccncc2c2sc3ccccc3c12 |
| InChI | InChI=1S/C16H10N2OS/c17-16(19)11-7-9-5-6-18-8-12(9)15-14(11)10-3-1-2-4-13(10)20-15/h1-8H,(H2,17,19) |
| InChIKey | OXGSQLSATTWJKY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide?
The IUPAC name of [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide (CID 5274983) is [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide.
What is the SMILES notation for [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide?
The canonical SMILES for [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide is NC(=O)c1cc2ccncc2c2sc3ccccc3c12.
What is the InChIKey of [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide?
The InChIKey is OXGSQLSATTWJKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2OS/c17-16(19)11-7-9-5-6-18-8-12(9)15-14(11)10-3-1-2-4-13(10)20-15/h1-8H,(H2,17,19).
What are the key properties of [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide?
[1]benzothiolo[3,2-h]isoquinoline-6-carboxamide has a molecular weight of 278.34 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiolo[3,2-h]isoquinoline-6-carboxamide is sourced from PubChem (CID 5274983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).