C20H17N7O3 — CID 5275145
2-[(1-naphthalen-1-yltetrazol-5-yl)methylamino]-N-(2-nitrophenyl)acetamide (PubChem CID 5275145) has the molecular formula C20H17N7O3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 2-[(1-naphthalen-1-yltetrazol-5-yl)methylamino]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(1-naphthalen-1-yltetrazol-5-yl)methylamino]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 5275145 |
| Molecular Formula | C20H17N7O3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[(1-naphthalen-1-yltetrazol-5-yl)methylamino]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CNCc1nnnn1-c1cccc2ccccc12)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17N7O3/c28-20(22-16-9-3-4-10-18(16)27(29)30)13-21-12-19-23-24-25-26(19)17-11-5-7-14-6-1-2-8-15(14)17/h1-11,21H,12-13H2,(H,22,28) |
| InChIKey | HMLWBKLOTCSHLC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|