C21H26O5 — CID 5275308
(8R,9S)-5-[(E)-but-2-enoxy]-10-hydroxy-8,9-dimethyl-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one (PubChem CID 5275308) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (8R,9S)-5-[(E)-but-2-enoxy]-10-hydroxy-8,9-dimethyl-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one.
| Compound Name | (8R,9S)-5-[(E)-but-2-enoxy]-10-hydroxy-8,9-dimethyl-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 5275308 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (8R,9S)-5-[(E)-but-2-enoxy]-10-hydroxy-8,9-dimethyl-4-propyl-9,10-dihydro-8H-pyrano[2,3-h]chromen-2-one |
| SMILES | C/C=C/COc1cc2c(c3oc(=O)cc(CCC)c13)C(O)[C@H](C)[C@@H](C)O2 |
| InChI | InChI=1S/C21H26O5/c1-5-7-9-24-15-11-16-19(20(23)12(3)13(4)25-16)21-18(15)14(8-6-2)10-17(22)26-21/h5,7,10-13,20,23H,6,8-9H2,1-4H3/b7-5+/t12-,13-,20?/m1/s1 |
| InChIKey | WIPYKPZTDPXOHH-VQNVJYSSSA-N |
| XLogP | 4.15 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|